C23H29NO3S — CID 134907498
(4S,5S)-4-(4-methylphenyl)sulfonyl-5-(7-phenylheptyl)-4,5-dihydro-1,3-oxazole (PubChem CID 134907498) has the molecular formula C23H29NO3S and a molecular weight of 399.56 g/mol. Its IUPAC name is (4S,5S)-4-(4-methylphenyl)sulfonyl-5-(7-phenylheptyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S,5S)-4-(4-methylphenyl)sulfonyl-5-(7-phenylheptyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 134907498 |
| Molecular Formula | C23H29NO3S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | (4S,5S)-4-(4-methylphenyl)sulfonyl-5-(7-phenylheptyl)-4,5-dihydro-1,3-oxazole |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H]2N=CO[C@H]2CCCCCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H29NO3S/c1-19-14-16-21(17-15-19)28(25,26)23-22(27-18-24-23)13-9-4-2-3-6-10-20-11-7-5-8-12-20/h5,7-8,11-12,14-18,22-23H,2-4,6,9-10,13H2,1H3/t22-,23-/m0/s1 |
| InChIKey | JITBTBFJFDKZBV-GOTSBHOMSA-N |
| XLogP | 5.11 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|