C24H31NO3S — CID 134907499
(4S,5S)-4-(4-methylphenyl)sulfonyl-5-(8-phenyloctyl)-4,5-dihydro-1,3-oxazole (PubChem CID 134907499) has the molecular formula C24H31NO3S and a molecular weight of 413.58 g/mol. Its IUPAC name is (4S,5S)-4-(4-methylphenyl)sulfonyl-5-(8-phenyloctyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S,5S)-4-(4-methylphenyl)sulfonyl-5-(8-phenyloctyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 134907499 |
| Molecular Formula | C24H31NO3S |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | (4S,5S)-4-(4-methylphenyl)sulfonyl-5-(8-phenyloctyl)-4,5-dihydro-1,3-oxazole |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H]2N=CO[C@H]2CCCCCCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H31NO3S/c1-20-15-17-22(18-16-20)29(26,27)24-23(28-19-25-24)14-10-5-3-2-4-7-11-21-12-8-6-9-13-21/h6,8-9,12-13,15-19,23-24H,2-5,7,10-11,14H2,1H3/t23-,24-/m0/s1 |
| InChIKey | AEWFCRPFNNHRND-ZEQRLZLVSA-N |
| XLogP | 5.50 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|