C20H30O5S — CID 134907521
methyl 9-(benzenesulfonyl)-12-oxotridecanoate (PubChem CID 134907521) has the molecular formula C20H30O5S and a molecular weight of 382.52 g/mol. Its IUPAC name is methyl 9-(benzenesulfonyl)-12-oxotridecanoate.
| Compound Name | methyl 9-(benzenesulfonyl)-12-oxotridecanoate |
|---|---|
| PubChem CID | 134907521 |
| Molecular Formula | C20H30O5S |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | methyl 9-(benzenesulfonyl)-12-oxotridecanoate |
| SMILES | COC(=O)CCCCCCCC(CCC(C)=O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H30O5S/c1-17(21)15-16-19(26(23,24)18-11-8-6-9-12-18)13-7-4-3-5-10-14-20(22)25-2/h6,8-9,11-12,19H,3-5,7,10,13-16H2,1-2H3 |
| InChIKey | LFMQNRRGUZJZQR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|