About 3-ethyl-3,5,5-trimethyl-1-phenylpiperazin-2-one
3-ethyl-3,5,5-trimethyl-1-phenylpiperazin-2-one (PubChem CID 134907528) has the molecular formula C15H22N2O
and a molecular weight of 246.35 g/mol. Its IUPAC name is 3-ethyl-3,5,5-trimethyl-1-phenylpiperazin-2-one.
Molecular Properties
| Compound Name | 3-ethyl-3,5,5-trimethyl-1-phenylpiperazin-2-one |
| PubChem CID | 134907528 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 3-ethyl-3,5,5-trimethyl-1-phenylpiperazin-2-one |
| SMILES | CCC1(C)NC(C)(C)CN(c2ccccc2)C1=O |
| InChI | InChI=1S/C15H22N2O/c1-5-15(4)13(18)17(11-14(2,3)16-15)12-9-7-6-8-10-12/h6-10,16H,5,11H2,1-4H3 |
| InChIKey | AETWDJBUNOWGNF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-3,5,5-trimethyl-1-phenylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-3,5,5-trimethyl-1-phenylpiperazin-2-one?
The IUPAC name of 3-ethyl-3,5,5-trimethyl-1-phenylpiperazin-2-one (CID 134907528) is 3-ethyl-3,5,5-trimethyl-1-phenylpiperazin-2-one.
What is the SMILES notation for 3-ethyl-3,5,5-trimethyl-1-phenylpiperazin-2-one?
The canonical SMILES for 3-ethyl-3,5,5-trimethyl-1-phenylpiperazin-2-one is CCC1(C)NC(C)(C)CN(c2ccccc2)C1=O.
What is the InChIKey of 3-ethyl-3,5,5-trimethyl-1-phenylpiperazin-2-one?
The InChIKey is AETWDJBUNOWGNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O/c1-5-15(4)13(18)17(11-14(2,3)16-15)12-9-7-6-8-10-12/h6-10,16H,5,11H2,1-4H3.
What are the key properties of 3-ethyl-3,5,5-trimethyl-1-phenylpiperazin-2-one?
3-ethyl-3,5,5-trimethyl-1-phenylpiperazin-2-one has a molecular weight of 246.35 g/mol, XLogP of 2.57, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-3,5,5-trimethyl-1-phenylpiperazin-2-one is sourced from PubChem (CID 134907528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).