C25H33NO3S — CID 134907592
(4S,5S)-4-(4-methylphenyl)sulfonyl-5-(9-phenylnonyl)-4,5-dihydro-1,3-oxazole (PubChem CID 134907592) has the molecular formula C25H33NO3S and a molecular weight of 427.61 g/mol. Its IUPAC name is (4S,5S)-4-(4-methylphenyl)sulfonyl-5-(9-phenylnonyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S,5S)-4-(4-methylphenyl)sulfonyl-5-(9-phenylnonyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 134907592 |
| Molecular Formula | C25H33NO3S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | (4S,5S)-4-(4-methylphenyl)sulfonyl-5-(9-phenylnonyl)-4,5-dihydro-1,3-oxazole |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H]2N=CO[C@H]2CCCCCCCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H33NO3S/c1-21-16-18-23(19-17-21)30(27,28)25-24(29-20-26-25)15-11-6-4-2-3-5-8-12-22-13-9-7-10-14-22/h7,9-10,13-14,16-20,24-25H,2-6,8,11-12,15H2,1H3/t24-,25-/m0/s1 |
| InChIKey | XFSDRURHMFKLAQ-DQEYMECFSA-N |
| XLogP | 5.89 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|