C18H23NO4 — CID 134907824
ethyl (4R)-2-[(2R,3S)-2-methyl-3-[(E)-prop-1-enyl]oxiran-2-yl]-4-phenyl-1,3-oxazolidine-3-carboxylate (PubChem CID 134907824) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is ethyl (4R)-2-[(2R,3S)-2-methyl-3-[(E)-prop-1-enyl]oxiran-2-yl]-4-phenyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | ethyl (4R)-2-[(2R,3S)-2-methyl-3-[(E)-prop-1-enyl]oxiran-2-yl]-4-phenyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134907824 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | ethyl (4R)-2-[(2R,3S)-2-methyl-3-[(E)-prop-1-enyl]oxiran-2-yl]-4-phenyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C/C=C/[C@@H]1O[C@@]1(C)C1OC[C@@H](c2ccccc2)N1C(=O)OCC |
| InChI | InChI=1S/C18H23NO4/c1-4-9-15-18(3,23-15)16-19(17(20)21-5-2)14(12-22-16)13-10-7-6-8-11-13/h4,6-11,14-16H,5,12H2,1-3H3/b9-4+/t14-,15-,16?,18+/m0/s1 |
| InChIKey | ROQROWGZHFSBCO-OGHWDJTISA-N |
| XLogP | 3.28 |
| TPSA | 51.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|