About (E)-2-azidohept-3-ene
(E)-2-azidohept-3-ene (PubChem CID 134907885) has the molecular formula C7H13N3
and a molecular weight of 139.20 g/mol. Its IUPAC name is (E)-2-azidohept-3-ene.
Molecular Properties
| Compound Name | (E)-2-azidohept-3-ene |
| PubChem CID | 134907885 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | (E)-2-azidohept-3-ene |
| SMILES | CCC/C=C/C(C)N=[N+]=[N-] |
| InChI | InChI=1S/C7H13N3/c1-3-4-5-6-7(2)9-10-8/h5-7H,3-4H2,1-2H3/b6-5+ |
| InChIKey | HWSBBSCCUFENGP-AATRIKPKSA-N |
| XLogP | 3.04 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-azidohept-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-azidohept-3-ene?
The IUPAC name of (E)-2-azidohept-3-ene (CID 134907885) is (E)-2-azidohept-3-ene.
What is the SMILES notation for (E)-2-azidohept-3-ene?
The canonical SMILES for (E)-2-azidohept-3-ene is CCC/C=C/C(C)N=[N+]=[N-].
What is the InChIKey of (E)-2-azidohept-3-ene?
The InChIKey is HWSBBSCCUFENGP-AATRIKPKSA-N. The full InChI is InChI=1S/C7H13N3/c1-3-4-5-6-7(2)9-10-8/h5-7H,3-4H2,1-2H3/b6-5+.
What are the key properties of (E)-2-azidohept-3-ene?
(E)-2-azidohept-3-ene has a molecular weight of 139.20 g/mol, XLogP of 3.04, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-azidohept-3-ene is sourced from PubChem (CID 134907885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).