About 2-ethyl-1,3-benzoxaphosphole
2-ethyl-1,3-benzoxaphosphole (PubChem CID 134907950) has the molecular formula C9H9OP
and a molecular weight of 164.14 g/mol. Its IUPAC name is 2-ethyl-1,3-benzoxaphosphole.
Molecular Properties
| Compound Name | 2-ethyl-1,3-benzoxaphosphole |
| PubChem CID | 134907950 |
| Molecular Formula | C9H9OP |
| Molecular Weight | 164.14 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | 2-ethyl-1,3-benzoxaphosphole |
| SMILES | CCc1oc2ccccc2p1 |
| InChI | InChI=1S/C9H9OP/c1-2-9-10-7-5-3-4-6-8(7)11-9/h3-6H,2H2,1H3 |
| InChIKey | YQXOCKZKNPJLIP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.14 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-1,3-benzoxaphosphole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1,3-benzoxaphosphole?
The IUPAC name of 2-ethyl-1,3-benzoxaphosphole (CID 134907950) is 2-ethyl-1,3-benzoxaphosphole.
What is the SMILES notation for 2-ethyl-1,3-benzoxaphosphole?
The canonical SMILES for 2-ethyl-1,3-benzoxaphosphole is CCc1oc2ccccc2p1.
What is the InChIKey of 2-ethyl-1,3-benzoxaphosphole?
The InChIKey is YQXOCKZKNPJLIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9OP/c1-2-9-10-7-5-3-4-6-8(7)11-9/h3-6H,2H2,1H3.
What are the key properties of 2-ethyl-1,3-benzoxaphosphole?
2-ethyl-1,3-benzoxaphosphole has a molecular weight of 164.14 g/mol, XLogP of 3.58, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1,3-benzoxaphosphole is sourced from PubChem (CID 134907950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).