C10H7ClN2O4S2 — CID 134908307
4-(benzenesulfonylmethyl)-2-chloro-5-nitro-1,3-thiazole (PubChem CID 134908307) has the molecular formula C10H7ClN2O4S2 and a molecular weight of 318.76 g/mol. Its IUPAC name is 4-(benzenesulfonylmethyl)-2-chloro-5-nitro-1,3-thiazole.
| Compound Name | 4-(benzenesulfonylmethyl)-2-chloro-5-nitro-1,3-thiazole |
|---|---|
| PubChem CID | 134908307 |
| Molecular Formula | C10H7ClN2O4S2 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 317.95 |
| IUPAC Name | 4-(benzenesulfonylmethyl)-2-chloro-5-nitro-1,3-thiazole |
| SMILES | O=[N+]([O-])c1sc(Cl)nc1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C10H7ClN2O4S2/c11-10-12-8(9(18-10)13(14)15)6-19(16,17)7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | LAEUNTRDALKACW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 90.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|