C25H34O3 — CID 13490872
(8'S,13'S,14'S,16'E)-16'-ethylidene-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,6,7,8,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene]-17'-one (PubChem CID 13490872) has the molecular formula C25H34O3 and a molecular weight of 382.54 g/mol. Its IUPAC name is (8'S,13'S,14'S,16'E)-16'-ethylidene-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,6,7,8,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene]-17'-one.
| Compound Name | (8'S,13'S,14'S,16'E)-16'-ethylidene-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,6,7,8,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene]-17'-one |
|---|---|
| PubChem CID | 13490872 |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | (8'S,13'S,14'S,16'E)-16'-ethylidene-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,6,7,8,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene]-17'-one |
| SMILES | C/C=C1\C[C@H]2[C@@H]3CCC4=C(CCC5(C4)OCC(C)(C)CO5)C3=CC[C@]2(C)C1=O |
| InChI | InChI=1S/C25H34O3/c1-5-16-12-21-20-7-6-17-13-25(27-14-23(2,3)15-28-25)11-9-18(17)19(20)8-10-24(21,4)22(16)26/h5,8,20-21H,6-7,9-15H2,1-4H3/b16-5+/t20-,21+,24+/m1/s1 |
| InChIKey | RFXPOQVYWRSKNY-JCFIDWQPSA-N |
| XLogP | 5.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|