About 1-(4-methyl-1,3-diselenol-2-ylidene)piperidin-1-ium
1-(4-methyl-1,3-diselenol-2-ylidene)piperidin-1-ium (PubChem CID 134908844) has the molecular formula C9H14NSe2+
and a molecular weight of 294.14 g/mol. Its IUPAC name is 1-(4-methyl-1,3-diselenol-2-ylidene)piperidin-1-ium.
Molecular Properties
| Compound Name | 1-(4-methyl-1,3-diselenol-2-ylidene)piperidin-1-ium |
| PubChem CID | 134908844 |
| Molecular Formula | C9H14NSe2+ |
| Molecular Weight | 294.14 g/mol |
| Exact Mass | 295.95 |
| IUPAC Name | 1-(4-methyl-1,3-diselenol-2-ylidene)piperidin-1-ium |
| SMILES | Cc1c[se]c(=[N+]2CCCCC2)[se]1 |
| InChI | InChI=1S/C9H14NSe2/c1-8-7-11-9(12-8)10-5-3-2-4-6-10/h7H,2-6H2,1H3/q+1 |
| InChIKey | MDOFZFHMOGYIRO-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.14 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methyl-1,3-diselenol-2-ylidene)piperidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methyl-1,3-diselenol-2-ylidene)piperidin-1-ium?
The IUPAC name of 1-(4-methyl-1,3-diselenol-2-ylidene)piperidin-1-ium (CID 134908844) is 1-(4-methyl-1,3-diselenol-2-ylidene)piperidin-1-ium.
What is the SMILES notation for 1-(4-methyl-1,3-diselenol-2-ylidene)piperidin-1-ium?
The canonical SMILES for 1-(4-methyl-1,3-diselenol-2-ylidene)piperidin-1-ium is Cc1c[se]c(=[N+]2CCCCC2)[se]1.
What is the InChIKey of 1-(4-methyl-1,3-diselenol-2-ylidene)piperidin-1-ium?
The InChIKey is MDOFZFHMOGYIRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14NSe2/c1-8-7-11-9(12-8)10-5-3-2-4-6-10/h7H,2-6H2,1H3/q+1.
What are the key properties of 1-(4-methyl-1,3-diselenol-2-ylidene)piperidin-1-ium?
1-(4-methyl-1,3-diselenol-2-ylidene)piperidin-1-ium has a molecular weight of 294.14 g/mol, XLogP of 0.07, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methyl-1,3-diselenol-2-ylidene)piperidin-1-ium is sourced from PubChem (CID 134908844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).