About [3-(4-chlorophenyl)-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-dien-1-yl] perchlorate
[3-(4-chlorophenyl)-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-dien-1-yl] perchlorate (PubChem CID 134908926) has the molecular formula C11H10Cl2O4S3
and a molecular weight of 373.30 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-dien-1-yl] perchlorate.
Molecular Properties
| Compound Name | [3-(4-chlorophenyl)-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-dien-1-yl] perchlorate |
| PubChem CID | 134908926 |
| Molecular Formula | C11H10Cl2O4S3 |
| Molecular Weight | 373.30 g/mol |
| Exact Mass | 371.91 |
| IUPAC Name | [3-(4-chlorophenyl)-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-dien-1-yl] perchlorate |
| SMILES | CSC1=S(O[Cl+3]([O-])([O-])[O-])SC(c2ccc(Cl)cc2)=C1C |
| InChI | InChI=1S/C11H10Cl2O4S3/c1-7-10(8-3-5-9(12)6-4-8)19-20(11(7)18-2)17-13(14,15)16/h3-6H,1-2H3 |
| InChIKey | FTKYNAUFNFQNQI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 78.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-chlorophenyl)-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-dien-1-yl] perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-chlorophenyl)-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-dien-1-yl] perchlorate?
The IUPAC name of [3-(4-chlorophenyl)-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-dien-1-yl] perchlorate (CID 134908926) is [3-(4-chlorophenyl)-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-dien-1-yl] perchlorate.
What is the SMILES notation for [3-(4-chlorophenyl)-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-dien-1-yl] perchlorate?
The canonical SMILES for [3-(4-chlorophenyl)-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-dien-1-yl] perchlorate is CSC1=S(O[Cl+3]([O-])([O-])[O-])SC(c2ccc(Cl)cc2)=C1C.
What is the InChIKey of [3-(4-chlorophenyl)-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-dien-1-yl] perchlorate?
The InChIKey is FTKYNAUFNFQNQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Cl2O4S3/c1-7-10(8-3-5-9(12)6-4-8)19-20(11(7)18-2)17-13(14,15)16/h3-6H,1-2H3.
What are the key properties of [3-(4-chlorophenyl)-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-dien-1-yl] perchlorate?
[3-(4-chlorophenyl)-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-dien-1-yl] perchlorate has a molecular weight of 373.30 g/mol, XLogP of 1.32, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-chlorophenyl)-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-dien-1-yl] perchlorate is sourced from PubChem (CID 134908926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).