About 4-[3-(2,6-diphenylpyrylium-4-yl)phenyl]-2,6-diphenylpyrylium ditetrafluoroborate
4-[3-(2,6-diphenylpyrylium-4-yl)phenyl]-2,6-diphenylpyrylium ditetrafluoroborate (PubChem CID 134909445) has the molecular formula C40H28B2F8O2
and a molecular weight of 714.27 g/mol. Its IUPAC name is 4-[3-(2,6-diphenylpyrylium-4-yl)phenyl]-2,6-diphenylpyrylium ditetrafluoroborate.
Molecular Properties
| Compound Name | 4-[3-(2,6-diphenylpyrylium-4-yl)phenyl]-2,6-diphenylpyrylium ditetrafluoroborate |
| PubChem CID | 134909445 |
| Molecular Formula | C40H28B2F8O2 |
| Molecular Weight | 714.27 g/mol |
| Exact Mass | 714.21 |
| IUPAC Name | 4-[3-(2,6-diphenylpyrylium-4-yl)phenyl]-2,6-diphenylpyrylium ditetrafluoroborate |
| SMILES | F[B-](F)(F)F.F[B-](F)(F)F.c1ccc(-c2cc(-c3cccc(-c4cc(-c5ccccc5)[o+]c(-c5ccccc5)c4)c3)cc(-c3ccccc3)[o+]2)cc1 |
| InChI | InChI=1S/C40H28O2.2BF4/c1-5-14-29(15-6-1)37-25-35(26-38(41-37)30-16-7-2-8-17-30)33-22-13-23-34(24-33)36-27-39(31-18-9-3-10-19-31)42-40(28-36)32-20-11-4-12-21-32;2*2-1(3,4)5/h1-28H;;/q+2;2*-1 |
| InChIKey | DGWGHLMISLFDFE-UHFFFAOYSA-N |
| XLogP | 14.04 |
| TPSA | 22.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 714.27 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(2,6-diphenylpyrylium-4-yl)phenyl]-2,6-diphenylpyrylium ditetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(2,6-diphenylpyrylium-4-yl)phenyl]-2,6-diphenylpyrylium ditetrafluoroborate?
The IUPAC name of 4-[3-(2,6-diphenylpyrylium-4-yl)phenyl]-2,6-diphenylpyrylium ditetrafluoroborate (CID 134909445) is 4-[3-(2,6-diphenylpyrylium-4-yl)phenyl]-2,6-diphenylpyrylium ditetrafluoroborate.
What is the SMILES notation for 4-[3-(2,6-diphenylpyrylium-4-yl)phenyl]-2,6-diphenylpyrylium ditetrafluoroborate?
The canonical SMILES for 4-[3-(2,6-diphenylpyrylium-4-yl)phenyl]-2,6-diphenylpyrylium ditetrafluoroborate is F[B-](F)(F)F.F[B-](F)(F)F.c1ccc(-c2cc(-c3cccc(-c4cc(-c5ccccc5)[o+]c(-c5ccccc5)c4)c3)cc(-c3ccccc3)[o+]2)cc1.
What is the InChIKey of 4-[3-(2,6-diphenylpyrylium-4-yl)phenyl]-2,6-diphenylpyrylium ditetrafluoroborate?
The InChIKey is DGWGHLMISLFDFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H28O2.2BF4/c1-5-14-29(15-6-1)37-25-35(26-38(41-37)30-16-7-2-8-17-30)33-22-13-23-34(24-33)36-27-39(31-18-9-3-10-19-31)42-40(28-36)32-20-11-4-12-21-32;2*2-1(3,4)5/h1-28H;;/q+2;2*-1.
What are the key properties of 4-[3-(2,6-diphenylpyrylium-4-yl)phenyl]-2,6-diphenylpyrylium ditetrafluoroborate?
4-[3-(2,6-diphenylpyrylium-4-yl)phenyl]-2,6-diphenylpyrylium ditetrafluoroborate has a molecular weight of 714.27 g/mol, XLogP of 14.04, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2,6-diphenylpyrylium-4-yl)phenyl]-2,6-diphenylpyrylium ditetrafluoroborate is sourced from PubChem (CID 134909445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).