C17H19ClO7 — CID 134909653
2-(3,4-dimethoxyphenyl)-5,6,7,8-tetrahydrochromen-1-ium perchlorate (PubChem CID 134909653) has the molecular formula C17H19ClO7 and a molecular weight of 370.79 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5,6,7,8-tetrahydrochromen-1-ium perchlorate.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5,6,7,8-tetrahydrochromen-1-ium perchlorate |
|---|---|
| PubChem CID | 134909653 |
| Molecular Formula | C17H19ClO7 |
| Molecular Weight | 370.79 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5,6,7,8-tetrahydrochromen-1-ium perchlorate |
| SMILES | COc1ccc(-c2ccc3c([o+]2)CCCC3)cc1OC.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C17H19O3.ClHO4/c1-18-16-10-8-13(11-17(16)19-2)15-9-7-12-5-3-4-6-14(12)20-15;2-1(3,4)5/h7-11H,3-6H2,1-2H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | KXYZKPQQSIRIRL-UHFFFAOYSA-M |
| XLogP | -0.63 |
| TPSA | 122.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.79 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|