C9H11F6N3 — CID 134909816
4-butyl-1-(1,1,2,3,3,3-hexafluoropropyl)triazole (PubChem CID 134909816) has the molecular formula C9H11F6N3 and a molecular weight of 275.20 g/mol. Its IUPAC name is 4-butyl-1-(1,1,2,3,3,3-hexafluoropropyl)triazole.
| Compound Name | 4-butyl-1-(1,1,2,3,3,3-hexafluoropropyl)triazole |
|---|---|
| PubChem CID | 134909816 |
| Molecular Formula | C9H11F6N3 |
| Molecular Weight | 275.20 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 4-butyl-1-(1,1,2,3,3,3-hexafluoropropyl)triazole |
| SMILES | CCCCc1cn(C(F)(F)C(F)C(F)(F)F)nn1 |
| InChI | InChI=1S/C9H11F6N3/c1-2-3-4-6-5-18(17-16-6)9(14,15)7(10)8(11,12)13/h5,7H,2-4H2,1H3 |
| InChIKey | XHMACGUSVMTWJL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.20 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |