C36H24N2O7 — CID 134910472
2-[3,4-bis(quinolin-2-ylmethoxy)phenyl]-3-hydroxy-4-oxochromene-8-carboxylic acid (PubChem CID 134910472) has the molecular formula C36H24N2O7 and a molecular weight of 596.60 g/mol. Its IUPAC name is 2-[3,4-bis(quinolin-2-ylmethoxy)phenyl]-3-hydroxy-4-oxochromene-8-carboxylic acid.
| Compound Name | 2-[3,4-bis(quinolin-2-ylmethoxy)phenyl]-3-hydroxy-4-oxochromene-8-carboxylic acid |
|---|---|
| PubChem CID | 134910472 |
| Molecular Formula | C36H24N2O7 |
| Molecular Weight | 596.60 g/mol |
| Exact Mass | 596.16 |
| IUPAC Name | 2-[3,4-bis(quinolin-2-ylmethoxy)phenyl]-3-hydroxy-4-oxochromene-8-carboxylic acid |
| SMILES | O=C(O)c1cccc2c(=O)c(O)c(-c3ccc(OCc4ccc5ccccc5n4)c(OCc4ccc5ccccc5n4)c3)oc12 |
| InChI | InChI=1S/C36H24N2O7/c39-32-26-8-5-9-27(36(41)42)35(26)45-34(33(32)40)23-14-17-30(43-19-24-15-12-21-6-1-3-10-28(21)37-24)31(18-23)44-20-25-16-13-22-7-2-4-11-29(22)38-25/h1-18,40H,19-20H2,(H,41,42) |
| InChIKey | YPRYBGKSOYCWTJ-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 131.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.60 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |