C32H38O4S — CID 134911099
2,6-ditert-butyl-4-(2,4,6-trimethylphenyl)pyrylium;naphthalene-2-sulfonate (PubChem CID 134911099) has the molecular formula C32H38O4S and a molecular weight of 518.72 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(2,4,6-trimethylphenyl)pyrylium;naphthalene-2-sulfonate.
| Compound Name | 2,6-ditert-butyl-4-(2,4,6-trimethylphenyl)pyrylium;naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 134911099 |
| Molecular Formula | C32H38O4S |
| Molecular Weight | 518.72 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 2,6-ditert-butyl-4-(2,4,6-trimethylphenyl)pyrylium;naphthalene-2-sulfonate |
| SMILES | Cc1cc(C)c(-c2cc(C(C)(C)C)[o+]c(C(C)(C)C)c2)c(C)c1.O=S(=O)([O-])c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H31O.C10H8O3S/c1-14-10-15(2)20(16(3)11-14)17-12-18(21(4,5)6)23-19(13-17)22(7,8)9;11-14(12,13)10-6-5-8-3-1-2-4-9(8)7-10/h10-13H,1-9H3;1-7H,(H,11,12,13)/q+1;/p-1 |
| InChIKey | OFDLCKBSHMNIIW-UHFFFAOYSA-M |
| XLogP | 8.49 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.72 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|