C17H19O+ — CID 134911135
2-(4-methylphenyl)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyran-1-ium (PubChem CID 134911135) has the molecular formula C17H19O+ and a molecular weight of 239.34 g/mol. Its IUPAC name is 2-(4-methylphenyl)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyran-1-ium.
| Compound Name | 2-(4-methylphenyl)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyran-1-ium |
|---|---|
| PubChem CID | 134911135 |
| Molecular Formula | C17H19O+ |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 2-(4-methylphenyl)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyran-1-ium |
| SMILES | Cc1ccc(-c2ccc3c([o+]2)CCCCC3)cc1 |
| InChI | InChI=1S/C17H19O/c1-13-7-9-15(10-8-13)17-12-11-14-5-3-2-4-6-16(14)18-17/h7-12H,2-6H2,1H3/q+1 |
| InChIKey | VZWHBOYSERDGCT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|