C29H31ClN2O7 — CID 134911136
[(5E)-5-[(3-methoxyanilino)methylidene]-1,2,3,6,7,8-hexahydroxanthen-4-yl]methylidene-(3-methoxyphenyl)azanium perchlorate (PubChem CID 134911136) has the molecular formula C29H31ClN2O7 and a molecular weight of 555.03 g/mol. Its IUPAC name is [(5E)-5-[(3-methoxyanilino)methylidene]-1,2,3,6,7,8-hexahydroxanthen-4-yl]methylidene-(3-methoxyphenyl)azanium perchlorate.
| Compound Name | [(5E)-5-[(3-methoxyanilino)methylidene]-1,2,3,6,7,8-hexahydroxanthen-4-yl]methylidene-(3-methoxyphenyl)azanium perchlorate |
|---|---|
| PubChem CID | 134911136 |
| Molecular Formula | C29H31ClN2O7 |
| Molecular Weight | 555.03 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | [(5E)-5-[(3-methoxyanilino)methylidene]-1,2,3,6,7,8-hexahydroxanthen-4-yl]methylidene-(3-methoxyphenyl)azanium perchlorate |
| SMILES | COc1cccc(N/C=C2\CCCC3=C2OC2=C(/C=[NH+]/c4cccc(OC)c4)CCCC2=C3)c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C29H30N2O3.ClHO4/c1-32-26-13-5-11-24(16-26)30-18-22-9-3-7-20-15-21-8-4-10-23(29(21)34-28(20)22)19-31-25-12-6-14-27(17-25)33-2;2-1(3,4)5/h5-6,11-19,30H,3-4,7-10H2,1-2H3;(H,2,3,4,5)/b22-18+,31-19+; |
| InChIKey | NCBXRWIFSIADFG-YVYRYTLMSA-N |
| XLogP | 0.56 |
| TPSA | 145.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.03 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|