About 6-methylpyrano[3,2-g][1,3]benzoxazol-8-one
6-methylpyrano[3,2-g][1,3]benzoxazol-8-one (PubChem CID 134911765) has the molecular formula C11H7NO3
and a molecular weight of 201.18 g/mol. Its IUPAC name is 6-methylpyrano[3,2-g][1,3]benzoxazol-8-one.
Molecular Properties
| Compound Name | 6-methylpyrano[3,2-g][1,3]benzoxazol-8-one |
| PubChem CID | 134911765 |
| Molecular Formula | C11H7NO3 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 6-methylpyrano[3,2-g][1,3]benzoxazol-8-one |
| SMILES | Cc1cc(=O)oc2c1ccc1ncoc12 |
| InChI | InChI=1S/C11H7NO3/c1-6-4-9(13)15-10-7(6)2-3-8-11(10)14-5-12-8/h2-5H,1H3 |
| InChIKey | NVBAMYUVBCUSNU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 6-methylpyrano[3,2-g][1,3]benzoxazol-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylpyrano[3,2-g][1,3]benzoxazol-8-one?
The IUPAC name of 6-methylpyrano[3,2-g][1,3]benzoxazol-8-one (CID 134911765) is 6-methylpyrano[3,2-g][1,3]benzoxazol-8-one.
What is the SMILES notation for 6-methylpyrano[3,2-g][1,3]benzoxazol-8-one?
The canonical SMILES for 6-methylpyrano[3,2-g][1,3]benzoxazol-8-one is Cc1cc(=O)oc2c1ccc1ncoc12.
What is the InChIKey of 6-methylpyrano[3,2-g][1,3]benzoxazol-8-one?
The InChIKey is NVBAMYUVBCUSNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NO3/c1-6-4-9(13)15-10-7(6)2-3-8-11(10)14-5-12-8/h2-5H,1H3.
What are the key properties of 6-methylpyrano[3,2-g][1,3]benzoxazol-8-one?
6-methylpyrano[3,2-g][1,3]benzoxazol-8-one has a molecular weight of 201.18 g/mol, XLogP of 2.24, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylpyrano[3,2-g][1,3]benzoxazol-8-one is sourced from PubChem (CID 134911765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).