About 3-amino-7,8-dimethoxy-6-nitrochromen-2-one
3-amino-7,8-dimethoxy-6-nitrochromen-2-one (PubChem CID 134912023) has the molecular formula C11H10N2O6
and a molecular weight of 266.21 g/mol. Its IUPAC name is 3-amino-7,8-dimethoxy-6-nitrochromen-2-one.
Molecular Properties
| Compound Name | 3-amino-7,8-dimethoxy-6-nitrochromen-2-one |
| PubChem CID | 134912023 |
| Molecular Formula | C11H10N2O6 |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 3-amino-7,8-dimethoxy-6-nitrochromen-2-one |
| SMILES | COc1c([N+](=O)[O-])cc2cc(N)c(=O)oc2c1OC |
| InChI | InChI=1S/C11H10N2O6/c1-17-9-7(13(15)16)4-5-3-6(12)11(14)19-8(5)10(9)18-2/h3-4H,12H2,1-2H3 |
| InChIKey | VHOSPWZCGFBMKS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 117.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-7,8-dimethoxy-6-nitrochromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-7,8-dimethoxy-6-nitrochromen-2-one?
The IUPAC name of 3-amino-7,8-dimethoxy-6-nitrochromen-2-one (CID 134912023) is 3-amino-7,8-dimethoxy-6-nitrochromen-2-one.
What is the SMILES notation for 3-amino-7,8-dimethoxy-6-nitrochromen-2-one?
The canonical SMILES for 3-amino-7,8-dimethoxy-6-nitrochromen-2-one is COc1c([N+](=O)[O-])cc2cc(N)c(=O)oc2c1OC.
What is the InChIKey of 3-amino-7,8-dimethoxy-6-nitrochromen-2-one?
The InChIKey is VHOSPWZCGFBMKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O6/c1-17-9-7(13(15)16)4-5-3-6(12)11(14)19-8(5)10(9)18-2/h3-4H,12H2,1-2H3.
What are the key properties of 3-amino-7,8-dimethoxy-6-nitrochromen-2-one?
3-amino-7,8-dimethoxy-6-nitrochromen-2-one has a molecular weight of 266.21 g/mol, XLogP of 1.30, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-7,8-dimethoxy-6-nitrochromen-2-one is sourced from PubChem (CID 134912023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).