About 2-(benzotriazol-2-yl)-6-tert-butyl-4-(2,2-dimethylpropyl)phenol
2-(benzotriazol-2-yl)-6-tert-butyl-4-(2,2-dimethylpropyl)phenol (PubChem CID 134912355) has the molecular formula C21H27N3O
and a molecular weight of 337.47 g/mol. Its IUPAC name is 2-(benzotriazol-2-yl)-6-tert-butyl-4-(2,2-dimethylpropyl)phenol.
Molecular Properties
| Compound Name | 2-(benzotriazol-2-yl)-6-tert-butyl-4-(2,2-dimethylpropyl)phenol |
| PubChem CID | 134912355 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 2-(benzotriazol-2-yl)-6-tert-butyl-4-(2,2-dimethylpropyl)phenol |
| SMILES | CC(C)(C)Cc1cc(-n2nc3ccccc3n2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H27N3O/c1-20(2,3)13-14-11-15(21(4,5)6)19(25)18(12-14)24-22-16-9-7-8-10-17(16)23-24/h7-12,25H,13H2,1-6H3 |
| InChIKey | AZJROUWIUINKFT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(benzotriazol-2-yl)-6-tert-butyl-4-(2,2-dimethylpropyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzotriazol-2-yl)-6-tert-butyl-4-(2,2-dimethylpropyl)phenol?
The IUPAC name of 2-(benzotriazol-2-yl)-6-tert-butyl-4-(2,2-dimethylpropyl)phenol (CID 134912355) is 2-(benzotriazol-2-yl)-6-tert-butyl-4-(2,2-dimethylpropyl)phenol.
What is the SMILES notation for 2-(benzotriazol-2-yl)-6-tert-butyl-4-(2,2-dimethylpropyl)phenol?
The canonical SMILES for 2-(benzotriazol-2-yl)-6-tert-butyl-4-(2,2-dimethylpropyl)phenol is CC(C)(C)Cc1cc(-n2nc3ccccc3n2)c(O)c(C(C)(C)C)c1.
What is the InChIKey of 2-(benzotriazol-2-yl)-6-tert-butyl-4-(2,2-dimethylpropyl)phenol?
The InChIKey is AZJROUWIUINKFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N3O/c1-20(2,3)13-14-11-15(21(4,5)6)19(25)18(12-14)24-22-16-9-7-8-10-17(16)23-24/h7-12,25H,13H2,1-6H3.
What are the key properties of 2-(benzotriazol-2-yl)-6-tert-butyl-4-(2,2-dimethylpropyl)phenol?
2-(benzotriazol-2-yl)-6-tert-butyl-4-(2,2-dimethylpropyl)phenol has a molecular weight of 337.47 g/mol, XLogP of 5.01, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzotriazol-2-yl)-6-tert-butyl-4-(2,2-dimethylpropyl)phenol is sourced from PubChem (CID 134912355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).