C8H10N2O2 — CID 134912762
(7S,8R)-5,6,7,8-tetrahydroquinazoline-7,8-diol (PubChem CID 134912762) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is (7S,8R)-5,6,7,8-tetrahydroquinazoline-7,8-diol.
| Compound Name | (7S,8R)-5,6,7,8-tetrahydroquinazoline-7,8-diol |
|---|---|
| PubChem CID | 134912762 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | (7S,8R)-5,6,7,8-tetrahydroquinazoline-7,8-diol |
| SMILES | O[C@@H]1c2ncncc2CC[C@@H]1O |
| InChI | InChI=1S/C8H10N2O2/c11-6-2-1-5-3-9-4-10-7(5)8(6)12/h3-4,6,8,11-12H,1-2H2/t6-,8-/m0/s1 |
| InChIKey | RYZNGFQUBXIEBA-XPUUQOCRSA-N |
| XLogP | -0.18 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |