C23H18ClNO3 — CID 134912871
1-(4-chlorophenyl)-6,7-dimethoxy-2-phenylisoquinolin-3-one (PubChem CID 134912871) has the molecular formula C23H18ClNO3 and a molecular weight of 391.85 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-6,7-dimethoxy-2-phenylisoquinolin-3-one.
| Compound Name | 1-(4-chlorophenyl)-6,7-dimethoxy-2-phenylisoquinolin-3-one |
|---|---|
| PubChem CID | 134912871 |
| Molecular Formula | C23H18ClNO3 |
| Molecular Weight | 391.85 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 1-(4-chlorophenyl)-6,7-dimethoxy-2-phenylisoquinolin-3-one |
| SMILES | COc1cc2cc(=O)n(-c3ccccc3)c(-c3ccc(Cl)cc3)c2cc1OC |
| InChI | InChI=1S/C23H18ClNO3/c1-27-20-12-16-13-22(26)25(18-6-4-3-5-7-18)23(19(16)14-21(20)28-2)15-8-10-17(24)11-9-15/h3-14H,1-2H3 |
| InChIKey | OMHXEEVGQKGARA-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.85 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |