About 1-(4-chlorophenyl)-6,7-dimethoxy-2-phenylisoquinolin-3-one
1-(4-chlorophenyl)-6,7-dimethoxy-2-phenylisoquinolin-3-one (PubChem CID 134912871) has the molecular formula C23H18ClNO3
and a molecular weight of 391.85 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-6,7-dimethoxy-2-phenylisoquinolin-3-one.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-6,7-dimethoxy-2-phenylisoquinolin-3-one |
| PubChem CID | 134912871 |
| Molecular Formula | C23H18ClNO3 |
| Molecular Weight | 391.85 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 1-(4-chlorophenyl)-6,7-dimethoxy-2-phenylisoquinolin-3-one |
| SMILES | COc1cc2cc(=O)n(-c3ccccc3)c(-c3ccc(Cl)cc3)c2cc1OC |
| InChI | InChI=1S/C23H18ClNO3/c1-27-20-12-16-13-22(26)25(18-6-4-3-5-7-18)23(19(16)14-21(20)28-2)15-8-10-17(24)11-9-15/h3-14H,1-2H3 |
| InChIKey | OMHXEEVGQKGARA-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.85 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-chlorophenyl)-6,7-dimethoxy-2-phenylisoquinolin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-6,7-dimethoxy-2-phenylisoquinolin-3-one?
The IUPAC name of 1-(4-chlorophenyl)-6,7-dimethoxy-2-phenylisoquinolin-3-one (CID 134912871) is 1-(4-chlorophenyl)-6,7-dimethoxy-2-phenylisoquinolin-3-one.
What is the SMILES notation for 1-(4-chlorophenyl)-6,7-dimethoxy-2-phenylisoquinolin-3-one?
The canonical SMILES for 1-(4-chlorophenyl)-6,7-dimethoxy-2-phenylisoquinolin-3-one is COc1cc2cc(=O)n(-c3ccccc3)c(-c3ccc(Cl)cc3)c2cc1OC.
What is the InChIKey of 1-(4-chlorophenyl)-6,7-dimethoxy-2-phenylisoquinolin-3-one?
The InChIKey is OMHXEEVGQKGARA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18ClNO3/c1-27-20-12-16-13-22(26)25(18-6-4-3-5-7-18)23(19(16)14-21(20)28-2)15-8-10-17(24)11-9-15/h3-14H,1-2H3.
What are the key properties of 1-(4-chlorophenyl)-6,7-dimethoxy-2-phenylisoquinolin-3-one?
1-(4-chlorophenyl)-6,7-dimethoxy-2-phenylisoquinolin-3-one has a molecular weight of 391.85 g/mol, XLogP of 5.33, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-6,7-dimethoxy-2-phenylisoquinolin-3-one is sourced from PubChem (CID 134912871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).