C26H26N2O3 — CID 134913465
(3R,4S)-3-[4-(dimethylamino)phenyl]-1-oxo-2-(2-phenylethyl)-3,4-dihydroisoquinoline-4-carboxylic acid (PubChem CID 134913465) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is (3R,4S)-3-[4-(dimethylamino)phenyl]-1-oxo-2-(2-phenylethyl)-3,4-dihydroisoquinoline-4-carboxylic acid.
| Compound Name | (3R,4S)-3-[4-(dimethylamino)phenyl]-1-oxo-2-(2-phenylethyl)-3,4-dihydroisoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 134913465 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | (3R,4S)-3-[4-(dimethylamino)phenyl]-1-oxo-2-(2-phenylethyl)-3,4-dihydroisoquinoline-4-carboxylic acid |
| SMILES | CN(C)c1ccc([C@H]2[C@@H](C(=O)O)c3ccccc3C(=O)N2CCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H26N2O3/c1-27(2)20-14-12-19(13-15-20)24-23(26(30)31)21-10-6-7-11-22(21)25(29)28(24)17-16-18-8-4-3-5-9-18/h3-15,23-24H,16-17H2,1-2H3,(H,30,31)/t23-,24-/m0/s1 |
| InChIKey | VIBOCPSSTNMWBD-ZEQRLZLVSA-N |
| XLogP | 4.36 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|