C31H45NO5 — CID 134913489
(1S,2R,5S)-2-[2-[(1R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]propan-2-yl]-5-methylcyclohexan-1-ol (PubChem CID 134913489) has the molecular formula C31H45NO5 and a molecular weight of 511.70 g/mol. Its IUPAC name is (1S,2R,5S)-2-[2-[(1R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]propan-2-yl]-5-methylcyclohexan-1-ol.
| Compound Name | (1S,2R,5S)-2-[2-[(1R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]propan-2-yl]-5-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 134913489 |
| Molecular Formula | C31H45NO5 |
| Molecular Weight | 511.70 g/mol |
| Exact Mass | 511.33 |
| IUPAC Name | (1S,2R,5S)-2-[2-[(1R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]propan-2-yl]-5-methylcyclohexan-1-ol |
| SMILES | COc1ccc(CC[C@@H]2c3cc(OC)c(OC)cc3CCN2C(C)(C)[C@H]2CC[C@H](C)C[C@@H]2O)cc1OC |
| InChI | InChI=1S/C31H45NO5/c1-20-8-11-24(26(33)16-20)31(2,3)32-15-14-22-18-29(36-6)30(37-7)19-23(22)25(32)12-9-21-10-13-27(34-4)28(17-21)35-5/h10,13,17-20,24-26,33H,8-9,11-12,14-16H2,1-7H3/t20-,24-,25+,26-/m0/s1 |
| InChIKey | MYGWBFMXCPOKSC-JTMVAAEOSA-N |
| XLogP | 5.83 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.70 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |