About (E)-3-[3-(cyclohexen-1-yl)isoquinolin-4-yl]-N,N-dimethylprop-2-enamide
(E)-3-[3-(cyclohexen-1-yl)isoquinolin-4-yl]-N,N-dimethylprop-2-enamide (PubChem CID 134913490) has the molecular formula C20H22N2O
and a molecular weight of 306.41 g/mol. Its IUPAC name is (E)-3-[3-(cyclohexen-1-yl)isoquinolin-4-yl]-N,N-dimethylprop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-[3-(cyclohexen-1-yl)isoquinolin-4-yl]-N,N-dimethylprop-2-enamide |
| PubChem CID | 134913490 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (E)-3-[3-(cyclohexen-1-yl)isoquinolin-4-yl]-N,N-dimethylprop-2-enamide |
| SMILES | CN(C)C(=O)/C=C/c1c(C2=CCCCC2)ncc2ccccc12 |
| InChI | InChI=1S/C20H22N2O/c1-22(2)19(23)13-12-18-17-11-7-6-10-16(17)14-21-20(18)15-8-4-3-5-9-15/h6-8,10-14H,3-5,9H2,1-2H3/b13-12+ |
| InChIKey | PXAIFBICDSWRDI-OUKQBFOZSA-N |
| XLogP | 4.29 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[3-(cyclohexen-1-yl)isoquinolin-4-yl]-N,N-dimethylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[3-(cyclohexen-1-yl)isoquinolin-4-yl]-N,N-dimethylprop-2-enamide?
The IUPAC name of (E)-3-[3-(cyclohexen-1-yl)isoquinolin-4-yl]-N,N-dimethylprop-2-enamide (CID 134913490) is (E)-3-[3-(cyclohexen-1-yl)isoquinolin-4-yl]-N,N-dimethylprop-2-enamide.
What is the SMILES notation for (E)-3-[3-(cyclohexen-1-yl)isoquinolin-4-yl]-N,N-dimethylprop-2-enamide?
The canonical SMILES for (E)-3-[3-(cyclohexen-1-yl)isoquinolin-4-yl]-N,N-dimethylprop-2-enamide is CN(C)C(=O)/C=C/c1c(C2=CCCCC2)ncc2ccccc12.
What is the InChIKey of (E)-3-[3-(cyclohexen-1-yl)isoquinolin-4-yl]-N,N-dimethylprop-2-enamide?
The InChIKey is PXAIFBICDSWRDI-OUKQBFOZSA-N. The full InChI is InChI=1S/C20H22N2O/c1-22(2)19(23)13-12-18-17-11-7-6-10-16(17)14-21-20(18)15-8-4-3-5-9-15/h6-8,10-14H,3-5,9H2,1-2H3/b13-12+.
What are the key properties of (E)-3-[3-(cyclohexen-1-yl)isoquinolin-4-yl]-N,N-dimethylprop-2-enamide?
(E)-3-[3-(cyclohexen-1-yl)isoquinolin-4-yl]-N,N-dimethylprop-2-enamide has a molecular weight of 306.41 g/mol, XLogP of 4.29, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[3-(cyclohexen-1-yl)isoquinolin-4-yl]-N,N-dimethylprop-2-enamide is sourced from PubChem (CID 134913490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).