About 4-cyclohexyl-1,2-dihydroisoquinoline
4-cyclohexyl-1,2-dihydroisoquinoline (PubChem CID 134913525) has the molecular formula C15H19N
and a molecular weight of 213.32 g/mol. Its IUPAC name is 4-cyclohexyl-1,2-dihydroisoquinoline.
Molecular Properties
| Compound Name | 4-cyclohexyl-1,2-dihydroisoquinoline |
| PubChem CID | 134913525 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 4-cyclohexyl-1,2-dihydroisoquinoline |
| SMILES | C1=C(C2CCCCC2)c2ccccc2CN1 |
| InChI | InChI=1S/C15H19N/c1-2-6-12(7-3-1)15-11-16-10-13-8-4-5-9-14(13)15/h4-5,8-9,11-12,16H,1-3,6-7,10H2 |
| InChIKey | KGEFXRTVHGAVNI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-cyclohexyl-1,2-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexyl-1,2-dihydroisoquinoline?
The IUPAC name of 4-cyclohexyl-1,2-dihydroisoquinoline (CID 134913525) is 4-cyclohexyl-1,2-dihydroisoquinoline.
What is the SMILES notation for 4-cyclohexyl-1,2-dihydroisoquinoline?
The canonical SMILES for 4-cyclohexyl-1,2-dihydroisoquinoline is C1=C(C2CCCCC2)c2ccccc2CN1.
What is the InChIKey of 4-cyclohexyl-1,2-dihydroisoquinoline?
The InChIKey is KGEFXRTVHGAVNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N/c1-2-6-12(7-3-1)15-11-16-10-13-8-4-5-9-14(13)15/h4-5,8-9,11-12,16H,1-3,6-7,10H2.
What are the key properties of 4-cyclohexyl-1,2-dihydroisoquinoline?
4-cyclohexyl-1,2-dihydroisoquinoline has a molecular weight of 213.32 g/mol, XLogP of 3.71, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexyl-1,2-dihydroisoquinoline is sourced from PubChem (CID 134913525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).