C24H21NO3 — CID 134913635
1-benzyl-5,7-dimethoxy-2-phenylquinolin-4-one (PubChem CID 134913635) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-benzyl-5,7-dimethoxy-2-phenylquinolin-4-one.
| Compound Name | 1-benzyl-5,7-dimethoxy-2-phenylquinolin-4-one |
|---|---|
| PubChem CID | 134913635 |
| Molecular Formula | C24H21NO3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 1-benzyl-5,7-dimethoxy-2-phenylquinolin-4-one |
| SMILES | COc1cc(OC)c2c(=O)cc(-c3ccccc3)n(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C24H21NO3/c1-27-19-13-21-24(23(14-19)28-2)22(26)15-20(18-11-7-4-8-12-18)25(21)16-17-9-5-3-6-10-17/h3-15H,16H2,1-2H3 |
| InChIKey | UWSNPZBEYUBLIG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |