C18H13ClN5O2+ — CID 134913752
5-(2-chlorophenyl)-7-methyl-6-(2H-tetrazol-5-yl)-[1,3]dioxolo[4,5-g]isoquinolin-6-ium (PubChem CID 134913752) has the molecular formula C18H13ClN5O2+ and a molecular weight of 366.79 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-7-methyl-6-(2H-tetrazol-5-yl)-[1,3]dioxolo[4,5-g]isoquinolin-6-ium.
| Compound Name | 5-(2-chlorophenyl)-7-methyl-6-(2H-tetrazol-5-yl)-[1,3]dioxolo[4,5-g]isoquinolin-6-ium |
|---|---|
| PubChem CID | 134913752 |
| Molecular Formula | C18H13ClN5O2+ |
| Molecular Weight | 366.79 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 5-(2-chlorophenyl)-7-methyl-6-(2H-tetrazol-5-yl)-[1,3]dioxolo[4,5-g]isoquinolin-6-ium |
| SMILES | Cc1cc2cc3c(cc2c(-c2ccccc2Cl)[n+]1-c1nn[nH]n1)OCO3 |
| InChI | InChI=1S/C18H13ClN5O2/c1-10-6-11-7-15-16(26-9-25-15)8-13(11)17(12-4-2-3-5-14(12)19)24(10)18-20-22-23-21-18/h2-8H,9H2,1H3,(H,20,21,22,23)/q+1 |
| InChIKey | ONCIJZFALXXTPK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 76.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.79 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|