C14H13NO4 — CID 134913839
methyl 2-benzyl-4-hydroxy-6-oxo-1H-pyridine-3-carboxylate (PubChem CID 134913839) has the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. Its IUPAC name is methyl 2-benzyl-4-hydroxy-6-oxo-1H-pyridine-3-carboxylate.
| Compound Name | methyl 2-benzyl-4-hydroxy-6-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134913839 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | methyl 2-benzyl-4-hydroxy-6-oxo-1H-pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(O)cc(=O)[nH]c1Cc1ccccc1 |
| InChI | InChI=1S/C14H13NO4/c1-19-14(18)13-10(15-12(17)8-11(13)16)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H2,15,16,17) |
| InChIKey | SCIFBVGBJSLGJU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |