C17H22N3O4S+ — CID 134913843
(5R,6S)-6-[(1R)-1-hydroxyethyl]-3-[2-[(1-methylpyridin-1-ium-2-yl)amino]ethylsulfanyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 134913843) has the molecular formula C17H22N3O4S+ and a molecular weight of 364.45 g/mol. Its IUPAC name is (5R,6S)-6-[(1R)-1-hydroxyethyl]-3-[2-[(1-methylpyridin-1-ium-2-yl)amino]ethylsulfanyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R,6S)-6-[(1R)-1-hydroxyethyl]-3-[2-[(1-methylpyridin-1-ium-2-yl)amino]ethylsulfanyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 134913843 |
| Molecular Formula | C17H22N3O4S+ |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | (5R,6S)-6-[(1R)-1-hydroxyethyl]-3-[2-[(1-methylpyridin-1-ium-2-yl)amino]ethylsulfanyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)O)=C(SCCNc3cccc[n+]3C)C[C@H]12 |
| InChI | InChI=1S/C17H21N3O4S/c1-10(21)14-11-9-12(15(17(23)24)20(11)16(14)22)25-8-6-18-13-5-3-4-7-19(13)2/h3-5,7,10-11,14,21H,6,8-9H2,1-2H3,(H,23,24)/p+1/t10-,11-,14-/m1/s1 |
| InChIKey | BTSKPASWFNDISM-JTNHKYCSSA-O |
| XLogP | 0.56 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|