C18H18N2O3 — CID 134913966
(3R,4S)-3-[4-(dimethylamino)phenyl]-1-oxo-3,4-dihydro-2H-isoquinoline-4-carboxylic acid (PubChem CID 134913966) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is (3R,4S)-3-[4-(dimethylamino)phenyl]-1-oxo-3,4-dihydro-2H-isoquinoline-4-carboxylic acid.
| Compound Name | (3R,4S)-3-[4-(dimethylamino)phenyl]-1-oxo-3,4-dihydro-2H-isoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 134913966 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | (3R,4S)-3-[4-(dimethylamino)phenyl]-1-oxo-3,4-dihydro-2H-isoquinoline-4-carboxylic acid |
| SMILES | CN(C)c1ccc([C@@H]2NC(=O)c3ccccc3[C@@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C18H18N2O3/c1-20(2)12-9-7-11(8-10-12)16-15(18(22)23)13-5-3-4-6-14(13)17(21)19-16/h3-10,15-16H,1-2H3,(H,19,21)(H,22,23)/t15-,16-/m0/s1 |
| InChIKey | PUTLGSSGEWVPKZ-HOTGVXAUSA-N |
| XLogP | 2.41 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|