C15H10Cl2N4O2 — CID 134914192
4,6-bis(3-chlorophenoxy)-1,3,5-triazin-2-amine (PubChem CID 134914192) has the molecular formula C15H10Cl2N4O2 and a molecular weight of 349.18 g/mol. Its IUPAC name is 4,6-bis(3-chlorophenoxy)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-bis(3-chlorophenoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 134914192 |
| Molecular Formula | C15H10Cl2N4O2 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 4,6-bis(3-chlorophenoxy)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(Oc2cccc(Cl)c2)nc(Oc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C15H10Cl2N4O2/c16-9-3-1-5-11(7-9)22-14-19-13(18)20-15(21-14)23-12-6-2-4-10(17)8-12/h1-8H,(H2,18,19,20,21) |
| InChIKey | AYAFCRKEUJKJPO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |