C13H12N2O2S2 — CID 134914805
methyl 4-methylsulfanyl-2-phenyl-6-sulfanylidene-1H-pyrimidine-5-carboxylate (PubChem CID 134914805) has the molecular formula C13H12N2O2S2 and a molecular weight of 292.39 g/mol. Its IUPAC name is methyl 4-methylsulfanyl-2-phenyl-6-sulfanylidene-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl 4-methylsulfanyl-2-phenyl-6-sulfanylidene-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 134914805 |
| Molecular Formula | C13H12N2O2S2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | methyl 4-methylsulfanyl-2-phenyl-6-sulfanylidene-1H-pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1c(SC)nc(-c2ccccc2)[nH]c1=S |
| InChI | InChI=1S/C13H12N2O2S2/c1-17-13(16)9-11(18)14-10(15-12(9)19-2)8-6-4-3-5-7-8/h3-7H,1-2H3,(H,14,15,18) |
| InChIKey | NOUHMUHGFCFSCJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|