About [2,6-bis(phenylmethoxy)pyrimidin-4-yl]hydrazine
[2,6-bis(phenylmethoxy)pyrimidin-4-yl]hydrazine (PubChem CID 134914887) has the molecular formula C18H18N4O2
and a molecular weight of 322.37 g/mol. Its IUPAC name is [2,6-bis(phenylmethoxy)pyrimidin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [2,6-bis(phenylmethoxy)pyrimidin-4-yl]hydrazine |
| PubChem CID | 134914887 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | [2,6-bis(phenylmethoxy)pyrimidin-4-yl]hydrazine |
| SMILES | NNc1cc(OCc2ccccc2)nc(OCc2ccccc2)n1 |
| InChI | InChI=1S/C18H18N4O2/c19-22-16-11-17(23-12-14-7-3-1-4-8-14)21-18(20-16)24-13-15-9-5-2-6-10-15/h1-11H,12-13,19H2,(H,20,21,22) |
| InChIKey | VQMQXSKFOMWQBV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2,6-bis(phenylmethoxy)pyrimidin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-bis(phenylmethoxy)pyrimidin-4-yl]hydrazine?
The IUPAC name of [2,6-bis(phenylmethoxy)pyrimidin-4-yl]hydrazine (CID 134914887) is [2,6-bis(phenylmethoxy)pyrimidin-4-yl]hydrazine.
What is the SMILES notation for [2,6-bis(phenylmethoxy)pyrimidin-4-yl]hydrazine?
The canonical SMILES for [2,6-bis(phenylmethoxy)pyrimidin-4-yl]hydrazine is NNc1cc(OCc2ccccc2)nc(OCc2ccccc2)n1.
What is the InChIKey of [2,6-bis(phenylmethoxy)pyrimidin-4-yl]hydrazine?
The InChIKey is VQMQXSKFOMWQBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4O2/c19-22-16-11-17(23-12-14-7-3-1-4-8-14)21-18(20-16)24-13-15-9-5-2-6-10-15/h1-11H,12-13,19H2,(H,20,21,22).
What are the key properties of [2,6-bis(phenylmethoxy)pyrimidin-4-yl]hydrazine?
[2,6-bis(phenylmethoxy)pyrimidin-4-yl]hydrazine has a molecular weight of 322.37 g/mol, XLogP of 2.92, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-bis(phenylmethoxy)pyrimidin-4-yl]hydrazine is sourced from PubChem (CID 134914887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).