C20H20Cl2N2O2S — CID 134915057
3-butyl-6-(3,4-dichlorophenyl)-2-(4-methoxyphenyl)-2H-1,3,5-oxadiazine-4-thione (PubChem CID 134915057) has the molecular formula C20H20Cl2N2O2S and a molecular weight of 423.37 g/mol. Its IUPAC name is 3-butyl-6-(3,4-dichlorophenyl)-2-(4-methoxyphenyl)-2H-1,3,5-oxadiazine-4-thione.
| Compound Name | 3-butyl-6-(3,4-dichlorophenyl)-2-(4-methoxyphenyl)-2H-1,3,5-oxadiazine-4-thione |
|---|---|
| PubChem CID | 134915057 |
| Molecular Formula | C20H20Cl2N2O2S |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 3-butyl-6-(3,4-dichlorophenyl)-2-(4-methoxyphenyl)-2H-1,3,5-oxadiazine-4-thione |
| SMILES | CCCCN1C(=S)N=C(c2ccc(Cl)c(Cl)c2)OC1c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H20Cl2N2O2S/c1-3-4-11-24-19(13-5-8-15(25-2)9-6-13)26-18(23-20(24)27)14-7-10-16(21)17(22)12-14/h5-10,12,19H,3-4,11H2,1-2H3 |
| InChIKey | NJKHJXMWWSEWDD-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|