C40H50O5Si2 — CID 134915073
(5R,7R)-5-[tert-butyl(diphenyl)silyl]oxy-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-ethyl-1,3-dioxepan-2-one (PubChem CID 134915073) has the molecular formula C40H50O5Si2 and a molecular weight of 667.01 g/mol. Its IUPAC name is (5R,7R)-5-[tert-butyl(diphenyl)silyl]oxy-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-ethyl-1,3-dioxepan-2-one.
| Compound Name | (5R,7R)-5-[tert-butyl(diphenyl)silyl]oxy-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-ethyl-1,3-dioxepan-2-one |
|---|---|
| PubChem CID | 134915073 |
| Molecular Formula | C40H50O5Si2 |
| Molecular Weight | 667.01 g/mol |
| Exact Mass | 666.32 |
| IUPAC Name | (5R,7R)-5-[tert-butyl(diphenyl)silyl]oxy-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-ethyl-1,3-dioxepan-2-one |
| SMILES | CC[C@@H]1C[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(=O)O1 |
| InChI | InChI=1S/C40H50O5Si2/c1-8-31-29-36(45-47(40(5,6)7,34-25-17-11-18-26-34)35-27-19-12-20-28-35)37(44-38(41)43-31)30-42-46(39(2,3)4,32-21-13-9-14-22-32)33-23-15-10-16-24-33/h9-28,31,36-37H,8,29-30H2,1-7H3/t31-,36-,37?/m1/s1 |
| InChIKey | MMBFPOKADHGMDC-DGAWOTTESA-N |
| XLogP | 7.21 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.01 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|