About 3-propyl-5-tetradecyl-1,3-oxazolidin-2-one
3-propyl-5-tetradecyl-1,3-oxazolidin-2-one (PubChem CID 134915171) has the molecular formula C20H39NO2
and a molecular weight of 325.54 g/mol. Its IUPAC name is 3-propyl-5-tetradecyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-propyl-5-tetradecyl-1,3-oxazolidin-2-one |
| PubChem CID | 134915171 |
| Molecular Formula | C20H39NO2 |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.30 |
| IUPAC Name | 3-propyl-5-tetradecyl-1,3-oxazolidin-2-one |
| SMILES | CCCCCCCCCCCCCCC1CN(CCC)C(=O)O1 |
| InChI | InChI=1S/C20H39NO2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-19-18-21(17-4-2)20(22)23-19/h19H,3-18H2,1-2H3 |
| InChIKey | MCPITXQZZSKQEK-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-propyl-5-tetradecyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propyl-5-tetradecyl-1,3-oxazolidin-2-one?
The IUPAC name of 3-propyl-5-tetradecyl-1,3-oxazolidin-2-one (CID 134915171) is 3-propyl-5-tetradecyl-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-propyl-5-tetradecyl-1,3-oxazolidin-2-one?
The canonical SMILES for 3-propyl-5-tetradecyl-1,3-oxazolidin-2-one is CCCCCCCCCCCCCCC1CN(CCC)C(=O)O1.
What is the InChIKey of 3-propyl-5-tetradecyl-1,3-oxazolidin-2-one?
The InChIKey is MCPITXQZZSKQEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H39NO2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-19-18-21(17-4-2)20(22)23-19/h19H,3-18H2,1-2H3.
What are the key properties of 3-propyl-5-tetradecyl-1,3-oxazolidin-2-one?
3-propyl-5-tetradecyl-1,3-oxazolidin-2-one has a molecular weight of 325.54 g/mol, XLogP of 6.31, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propyl-5-tetradecyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 134915171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).