C10H12Cl3NO6 — CID 13491540
[4-oxo-3-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl] acetate (PubChem CID 13491540) has the molecular formula C10H12Cl3NO6 and a molecular weight of 348.57 g/mol. Its IUPAC name is [4-oxo-3-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl] acetate.
| Compound Name | [4-oxo-3-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl] acetate |
|---|---|
| PubChem CID | 13491540 |
| Molecular Formula | C10H12Cl3NO6 |
| Molecular Weight | 348.57 g/mol |
| Exact Mass | 346.97 |
| IUPAC Name | [4-oxo-3-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl] acetate |
| SMILES | CC(=O)OC1NC(=O)C1C(C)OC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H12Cl3NO6/c1-4(19-9(17)18-3-10(11,12)13)6-7(16)14-8(6)20-5(2)15/h4,6,8H,3H2,1-2H3,(H,14,16) |
| InChIKey | FMVWHUBFYGPTGJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.57 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|