C18H24N2O3 — CID 134915410
ethyl 2-(3-cyclohexyl-2-oxo-1,4-dihydroquinazolin-4-yl)acetate (PubChem CID 134915410) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is ethyl 2-(3-cyclohexyl-2-oxo-1,4-dihydroquinazolin-4-yl)acetate.
| Compound Name | ethyl 2-(3-cyclohexyl-2-oxo-1,4-dihydroquinazolin-4-yl)acetate |
|---|---|
| PubChem CID | 134915410 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | ethyl 2-(3-cyclohexyl-2-oxo-1,4-dihydroquinazolin-4-yl)acetate |
| SMILES | CCOC(=O)CC1c2ccccc2NC(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C18H24N2O3/c1-2-23-17(21)12-16-14-10-6-7-11-15(14)19-18(22)20(16)13-8-4-3-5-9-13/h6-7,10-11,13,16H,2-5,8-9,12H2,1H3,(H,19,22) |
| InChIKey | GTUJDKNUQMPTFF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |