About 1-ethyl-3,3a-dihydro-2H-pyrrolo[2,3-b]azepine
1-ethyl-3,3a-dihydro-2H-pyrrolo[2,3-b]azepine (PubChem CID 134915495) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 1-ethyl-3,3a-dihydro-2H-pyrrolo[2,3-b]azepine.
Molecular Properties
| Compound Name | 1-ethyl-3,3a-dihydro-2H-pyrrolo[2,3-b]azepine |
| PubChem CID | 134915495 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1-ethyl-3,3a-dihydro-2H-pyrrolo[2,3-b]azepine |
| SMILES | CCN1CCC2C=CC=CN=C21 |
| InChI | InChI=1S/C10H14N2/c1-2-12-8-6-9-5-3-4-7-11-10(9)12/h3-5,7,9H,2,6,8H2,1H3 |
| InChIKey | KZIUXAOXLNHAAX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethyl-3,3a-dihydro-2H-pyrrolo[2,3-b]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3,3a-dihydro-2H-pyrrolo[2,3-b]azepine?
The IUPAC name of 1-ethyl-3,3a-dihydro-2H-pyrrolo[2,3-b]azepine (CID 134915495) is 1-ethyl-3,3a-dihydro-2H-pyrrolo[2,3-b]azepine.
What is the SMILES notation for 1-ethyl-3,3a-dihydro-2H-pyrrolo[2,3-b]azepine?
The canonical SMILES for 1-ethyl-3,3a-dihydro-2H-pyrrolo[2,3-b]azepine is CCN1CCC2C=CC=CN=C21.
What is the InChIKey of 1-ethyl-3,3a-dihydro-2H-pyrrolo[2,3-b]azepine?
The InChIKey is KZIUXAOXLNHAAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-2-12-8-6-9-5-3-4-7-11-10(9)12/h3-5,7,9H,2,6,8H2,1H3.
What are the key properties of 1-ethyl-3,3a-dihydro-2H-pyrrolo[2,3-b]azepine?
1-ethyl-3,3a-dihydro-2H-pyrrolo[2,3-b]azepine has a molecular weight of 162.24 g/mol, XLogP of 1.81, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3,3a-dihydro-2H-pyrrolo[2,3-b]azepine is sourced from PubChem (CID 134915495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).