C18H12O2S — CID 134915500
4-phenoxathiin-4-ylphenol (PubChem CID 134915500) has the molecular formula C18H12O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is 4-phenoxathiin-4-ylphenol.
| Compound Name | 4-phenoxathiin-4-ylphenol |
|---|---|
| PubChem CID | 134915500 |
| Molecular Formula | C18H12O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 4-phenoxathiin-4-ylphenol |
| SMILES | Oc1ccc(-c2cccc3c2Oc2ccccc2S3)cc1 |
| InChI | InChI=1S/C18H12O2S/c19-13-10-8-12(9-11-13)14-4-3-7-17-18(14)20-15-5-1-2-6-16(15)21-17/h1-11,19H |
| InChIKey | OYUYJLJOWPCEPT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |