C18H18N2 — CID 134915932
(1Z,7Z,11Z)-8,11-diethyl-9,10-diazatricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene (PubChem CID 134915932) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is (1Z,7Z,11Z)-8,11-diethyl-9,10-diazatricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene.
| Compound Name | (1Z,7Z,11Z)-8,11-diethyl-9,10-diazatricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene |
|---|---|
| PubChem CID | 134915932 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | (1Z,7Z,11Z)-8,11-diethyl-9,10-diazatricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene |
| SMILES | CCC1=c2\cccc\c2=c2/cccc/c2=C(CC)/N=N\1 |
| InChI | InChI=1S/C18H18N2/c1-3-17-15-11-7-5-9-13(15)14-10-6-8-12-16(14)18(4-2)20-19-17/h5-12H,3-4H2,1-2H3/b14-13-,17-15-,18-16-,19-17-,20-18-,20-19- |
| InChIKey | RZJVDYXVFSVWFC-ZIFXKFCRSA-N |
| XLogP | 3.48 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |