About (2E)-2-[(4,6-dimethoxy-3-pyridinyl)methylidene]-4-ethyl-3H-1,4-benzoxazine
(2E)-2-[(4,6-dimethoxy-3-pyridinyl)methylidene]-4-ethyl-3H-1,4-benzoxazine (PubChem CID 134915989) has the molecular formula C18H20N2O3
and a molecular weight of 312.37 g/mol. Its IUPAC name is (2E)-2-[(4,6-dimethoxy-3-pyridinyl)methylidene]-4-ethyl-3H-1,4-benzoxazine.
Molecular Properties
| Compound Name | (2E)-2-[(4,6-dimethoxy-3-pyridinyl)methylidene]-4-ethyl-3H-1,4-benzoxazine |
| PubChem CID | 134915989 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (2E)-2-[(4,6-dimethoxy-3-pyridinyl)methylidene]-4-ethyl-3H-1,4-benzoxazine |
| SMILES | CCN1C/C(=C\c2cnc(OC)cc2OC)Oc2ccccc21 |
| InChI | InChI=1S/C18H20N2O3/c1-4-20-12-14(23-16-8-6-5-7-15(16)20)9-13-11-19-18(22-3)10-17(13)21-2/h5-11H,4,12H2,1-3H3/b14-9+ |
| InChIKey | NYJQYAYMAPIWDL-NTEUORMPSA-N |
| XLogP | 3.36 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(4,6-dimethoxy-3-pyridinyl)methylidene]-4-ethyl-3H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(4,6-dimethoxy-3-pyridinyl)methylidene]-4-ethyl-3H-1,4-benzoxazine?
The IUPAC name of (2E)-2-[(4,6-dimethoxy-3-pyridinyl)methylidene]-4-ethyl-3H-1,4-benzoxazine (CID 134915989) is (2E)-2-[(4,6-dimethoxy-3-pyridinyl)methylidene]-4-ethyl-3H-1,4-benzoxazine.
What is the SMILES notation for (2E)-2-[(4,6-dimethoxy-3-pyridinyl)methylidene]-4-ethyl-3H-1,4-benzoxazine?
The canonical SMILES for (2E)-2-[(4,6-dimethoxy-3-pyridinyl)methylidene]-4-ethyl-3H-1,4-benzoxazine is CCN1C/C(=C\c2cnc(OC)cc2OC)Oc2ccccc21.
What is the InChIKey of (2E)-2-[(4,6-dimethoxy-3-pyridinyl)methylidene]-4-ethyl-3H-1,4-benzoxazine?
The InChIKey is NYJQYAYMAPIWDL-NTEUORMPSA-N. The full InChI is InChI=1S/C18H20N2O3/c1-4-20-12-14(23-16-8-6-5-7-15(16)20)9-13-11-19-18(22-3)10-17(13)21-2/h5-11H,4,12H2,1-3H3/b14-9+.
What are the key properties of (2E)-2-[(4,6-dimethoxy-3-pyridinyl)methylidene]-4-ethyl-3H-1,4-benzoxazine?
(2E)-2-[(4,6-dimethoxy-3-pyridinyl)methylidene]-4-ethyl-3H-1,4-benzoxazine has a molecular weight of 312.37 g/mol, XLogP of 3.36, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(4,6-dimethoxy-3-pyridinyl)methylidene]-4-ethyl-3H-1,4-benzoxazine is sourced from PubChem (CID 134915989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).