C13H13NO5S — CID 134916116
dimethyl (2S,3S)-4-formyl-2,3-dihydro-1,4-benzothiazine-2,3-dicarboxylate (PubChem CID 134916116) has the molecular formula C13H13NO5S and a molecular weight of 295.32 g/mol. Its IUPAC name is dimethyl (2S,3S)-4-formyl-2,3-dihydro-1,4-benzothiazine-2,3-dicarboxylate.
| Compound Name | dimethyl (2S,3S)-4-formyl-2,3-dihydro-1,4-benzothiazine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 134916116 |
| Molecular Formula | C13H13NO5S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | dimethyl (2S,3S)-4-formyl-2,3-dihydro-1,4-benzothiazine-2,3-dicarboxylate |
| SMILES | COC(=O)[C@H]1Sc2ccccc2N(C=O)[C@H]1C(=O)OC |
| InChI | InChI=1S/C13H13NO5S/c1-18-12(16)10-11(13(17)19-2)20-9-6-4-3-5-8(9)14(10)7-15/h3-7,10-11H,1-2H3/t10-,11+/m1/s1 |
| InChIKey | FHYUYKMZLLSJPN-MNOVXSKESA-N |
| XLogP | 0.84 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|