About 4-acetyl-6-methyl-3H-1,4-oxazin-2-one
4-acetyl-6-methyl-3H-1,4-oxazin-2-one (PubChem CID 134916175) has the molecular formula C7H9NO3
and a molecular weight of 155.15 g/mol. Its IUPAC name is 4-acetyl-6-methyl-3H-1,4-oxazin-2-one.
Molecular Properties
| Compound Name | 4-acetyl-6-methyl-3H-1,4-oxazin-2-one |
| PubChem CID | 134916175 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | 4-acetyl-6-methyl-3H-1,4-oxazin-2-one |
| SMILES | CC(=O)N1C=C(C)OC(=O)C1 |
| InChI | InChI=1S/C7H9NO3/c1-5-3-8(6(2)9)4-7(10)11-5/h3H,4H2,1-2H3 |
| InChIKey | STAORZHTJZSNKA-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-acetyl-6-methyl-3H-1,4-oxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-6-methyl-3H-1,4-oxazin-2-one?
The IUPAC name of 4-acetyl-6-methyl-3H-1,4-oxazin-2-one (CID 134916175) is 4-acetyl-6-methyl-3H-1,4-oxazin-2-one.
What is the SMILES notation for 4-acetyl-6-methyl-3H-1,4-oxazin-2-one?
The canonical SMILES for 4-acetyl-6-methyl-3H-1,4-oxazin-2-one is CC(=O)N1C=C(C)OC(=O)C1.
What is the InChIKey of 4-acetyl-6-methyl-3H-1,4-oxazin-2-one?
The InChIKey is STAORZHTJZSNKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3/c1-5-3-8(6(2)9)4-7(10)11-5/h3H,4H2,1-2H3.
What are the key properties of 4-acetyl-6-methyl-3H-1,4-oxazin-2-one?
4-acetyl-6-methyl-3H-1,4-oxazin-2-one has a molecular weight of 155.15 g/mol, XLogP of 0.25, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-6-methyl-3H-1,4-oxazin-2-one is sourced from PubChem (CID 134916175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).