C28H30O5S — CID 134916302
[[(4R,5R)-5-(benzhydryloxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylsulfanylmethyl] acetate (PubChem CID 134916302) has the molecular formula C28H30O5S and a molecular weight of 478.61 g/mol. Its IUPAC name is [[(4R,5R)-5-(benzhydryloxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylsulfanylmethyl] acetate.
| Compound Name | [[(4R,5R)-5-(benzhydryloxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylsulfanylmethyl] acetate |
|---|---|
| PubChem CID | 134916302 |
| Molecular Formula | C28H30O5S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | [[(4R,5R)-5-(benzhydryloxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylsulfanylmethyl] acetate |
| SMILES | CC(=O)OC(Sc1ccccc1)[C@@H]1OC(C)(C)O[C@@H]1COC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H30O5S/c1-20(29)31-27(34-23-17-11-6-12-18-23)26-24(32-28(2,3)33-26)19-30-25(21-13-7-4-8-14-21)22-15-9-5-10-16-22/h4-18,24-27H,19H2,1-3H3/t24-,26-,27?/m1/s1 |
| InChIKey | FJCHWNDMTTYWOW-WJNKLNLJSA-N |
| XLogP | 5.99 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|