C25H52O5Si2 — CID 134916360
methyl (E,4R,5R,6S,7R,8R)-7,9-bis[[tert-butyl(dimethyl)silyl]oxy]-5-hydroxy-4,6,8-trimethylnon-2-enoate (PubChem CID 134916360) has the molecular formula C25H52O5Si2 and a molecular weight of 488.86 g/mol. Its IUPAC name is methyl (E,4R,5R,6S,7R,8R)-7,9-bis[[tert-butyl(dimethyl)silyl]oxy]-5-hydroxy-4,6,8-trimethylnon-2-enoate.
| Compound Name | methyl (E,4R,5R,6S,7R,8R)-7,9-bis[[tert-butyl(dimethyl)silyl]oxy]-5-hydroxy-4,6,8-trimethylnon-2-enoate |
|---|---|
| PubChem CID | 134916360 |
| Molecular Formula | C25H52O5Si2 |
| Molecular Weight | 488.86 g/mol |
| Exact Mass | 488.34 |
| IUPAC Name | methyl (E,4R,5R,6S,7R,8R)-7,9-bis[[tert-butyl(dimethyl)silyl]oxy]-5-hydroxy-4,6,8-trimethylnon-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H](C)[C@@H](O)[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H52O5Si2/c1-18(15-16-21(26)28-10)22(27)20(3)23(30-32(13,14)25(7,8)9)19(2)17-29-31(11,12)24(4,5)6/h15-16,18-20,22-23,27H,17H2,1-14H3/b16-15+/t18-,19-,20+,22-,23-/m1/s1 |
| InChIKey | LFINRQUPPOBMFH-NXGGJLLYSA-N |
| XLogP | 6.40 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.86 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|