C14H21NO6 — CID 134916361
2-O-tert-butyl 1-O,3-O-dimethyl 2-azabicyclo[2.1.1]hexane-1,2,3-tricarboxylate (PubChem CID 134916361) has the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. Its IUPAC name is 2-O-tert-butyl 1-O,3-O-dimethyl 2-azabicyclo[2.1.1]hexane-1,2,3-tricarboxylate.
| Compound Name | 2-O-tert-butyl 1-O,3-O-dimethyl 2-azabicyclo[2.1.1]hexane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 134916361 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 2-O-tert-butyl 1-O,3-O-dimethyl 2-azabicyclo[2.1.1]hexane-1,2,3-tricarboxylate |
| SMILES | COC(=O)C1C2CC(C(=O)OC)(C2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H21NO6/c1-13(2,3)21-12(18)15-9(10(16)19-4)8-6-14(15,7-8)11(17)20-5/h8-9H,6-7H2,1-5H3 |
| InChIKey | QTXRDBLXTXAQEC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|